C20H21FN6O4 — CID 67123862
ethyl 4-[[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]amino]cyclohexane-1-carboxylate (PubChem CID 67123862) has the molecular formula C20H21FN6O4 and a molecular weight of 428.42 g/mol. Its IUPAC name is ethyl 4-[[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67123862 |
| Molecular Formula | C20H21FN6O4 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | ethyl 4-[[2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-5-nitropyrimidin-4-yl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Nc2nc(-c3cnc4ccc(F)cn34)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H21FN6O4/c1-2-31-20(28)12-3-6-14(7-4-12)24-19-16(27(29)30)10-23-18(25-19)15-9-22-17-8-5-13(21)11-26(15)17/h5,8-12,14H,2-4,6-7H2,1H3,(H,23,24,25) |
| InChIKey | OEPDQWOWIQOJET-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|