C15H15FN6O3 — CID 67124099
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-N-(1-methoxypropan-2-yl)-5-nitropyrimidin-4-amine (PubChem CID 67124099) has the molecular formula C15H15FN6O3 and a molecular weight of 346.32 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-N-(1-methoxypropan-2-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-N-(1-methoxypropan-2-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 67124099 |
| Molecular Formula | C15H15FN6O3 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-N-(1-methoxypropan-2-yl)-5-nitropyrimidin-4-amine |
| SMILES | COCC(C)Nc1nc(-c2cnc3ccc(F)cn23)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15FN6O3/c1-9(8-25-2)19-15-12(22(23)24)6-18-14(20-15)11-5-17-13-4-3-10(16)7-21(11)13/h3-7,9H,8H2,1-2H3,(H,18,19,20) |
| InChIKey | GPXWNMUDJNMKTH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|