C14H15F2N5O3 — CID 22538641
6-N-(2,5-difluorophenyl)-4-N-(1-methoxypropan-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22538641) has the molecular formula C14H15F2N5O3 and a molecular weight of 339.30 g/mol. Its IUPAC name is 6-N-(2,5-difluorophenyl)-4-N-(1-methoxypropan-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2,5-difluorophenyl)-4-N-(1-methoxypropan-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22538641 |
| Molecular Formula | C14H15F2N5O3 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 6-N-(2,5-difluorophenyl)-4-N-(1-methoxypropan-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COCC(C)Nc1ncnc(Nc2cc(F)ccc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15F2N5O3/c1-8(6-24-2)19-13-12(21(22)23)14(18-7-17-13)20-11-5-9(15)3-4-10(11)16/h3-5,7-8H,6H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | OQKPMNMKXSWCFH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|