C15H25N5O3 — CID 22538876
6-N-cycloheptyl-4-N-(1-methoxypropan-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22538876) has the molecular formula C15H25N5O3 and a molecular weight of 323.40 g/mol. Its IUPAC name is 6-N-cycloheptyl-4-N-(1-methoxypropan-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-cycloheptyl-4-N-(1-methoxypropan-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22538876 |
| Molecular Formula | C15H25N5O3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 6-N-cycloheptyl-4-N-(1-methoxypropan-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COCC(C)Nc1ncnc(NC2CCCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H25N5O3/c1-11(9-23-2)18-14-13(20(21)22)15(17-10-16-14)19-12-7-5-3-4-6-8-12/h10-12H,3-9H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | VPTXGAHCWQBZHP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|