C23H23FN4O4 — CID 67003513
N-cyclohexyl-N-ethyl-4-(6-fluoroimidazo[1,2-a]pyridine-3-carbonyl)-3-nitrobenzamide (PubChem CID 67003513) has the molecular formula C23H23FN4O4 and a molecular weight of 438.46 g/mol. Its IUPAC name is N-cyclohexyl-N-ethyl-4-(6-fluoroimidazo[1,2-a]pyridine-3-carbonyl)-3-nitrobenzamide.
| Compound Name | N-cyclohexyl-N-ethyl-4-(6-fluoroimidazo[1,2-a]pyridine-3-carbonyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 67003513 |
| Molecular Formula | C23H23FN4O4 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-cyclohexyl-N-ethyl-4-(6-fluoroimidazo[1,2-a]pyridine-3-carbonyl)-3-nitrobenzamide |
| SMILES | CCN(C(=O)c1ccc(C(=O)c2cnc3ccc(F)cn23)c([N+](=O)[O-])c1)C1CCCCC1 |
| InChI | InChI=1S/C23H23FN4O4/c1-2-26(17-6-4-3-5-7-17)23(30)15-8-10-18(19(12-15)28(31)32)22(29)20-13-25-21-11-9-16(24)14-27(20)21/h8-14,17H,2-7H2,1H3 |
| InChIKey | PZGSAGFCSBWBQM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|