C22H24N4O2 — CID 46847214
N-cyclohexyl-N-ethyl-4-(imidazo[1,2-a]pyrimidine-3-carbonyl)benzamide (PubChem CID 46847214) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-cyclohexyl-N-ethyl-4-(imidazo[1,2-a]pyrimidine-3-carbonyl)benzamide.
| Compound Name | N-cyclohexyl-N-ethyl-4-(imidazo[1,2-a]pyrimidine-3-carbonyl)benzamide |
|---|---|
| PubChem CID | 46847214 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-cyclohexyl-N-ethyl-4-(imidazo[1,2-a]pyrimidine-3-carbonyl)benzamide |
| SMILES | CCN(C(=O)c1ccc(C(=O)c2cnc3ncccn23)cc1)C1CCCCC1 |
| InChI | InChI=1S/C22H24N4O2/c1-2-25(18-7-4-3-5-8-18)21(28)17-11-9-16(10-12-17)20(27)19-15-24-22-23-13-6-14-26(19)22/h6,9-15,18H,2-5,7-8H2,1H3 |
| InChIKey | JWMJUTFVVIOOTP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |