C15H21FN2O2 — CID 67213320
ethyl 4-(2-amino-4-fluoroanilino)cyclohexane-1-carboxylate (PubChem CID 67213320) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is ethyl 4-(2-amino-4-fluoroanilino)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(2-amino-4-fluoroanilino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 67213320 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | ethyl 4-(2-amino-4-fluoroanilino)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Nc2ccc(F)cc2N)CC1 |
| InChI | InChI=1S/C15H21FN2O2/c1-2-20-15(19)10-3-6-12(7-4-10)18-14-8-5-11(16)9-13(14)17/h5,8-10,12,18H,2-4,6-7,17H2,1H3 |
| InChIKey | YASCSJWGROPKEJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|