C26H36N4O4 — CID 160671023
ethyl 3-amino-4-(cyclopentylamino)benzoate;ethyl 3-amino-4-(cyclopropylamino)benzoate (PubChem CID 160671023) has the molecular formula C26H36N4O4 and a molecular weight of 468.60 g/mol. Its IUPAC name is ethyl 3-amino-4-(cyclopentylamino)benzoate;ethyl 3-amino-4-(cyclopropylamino)benzoate.
| Compound Name | ethyl 3-amino-4-(cyclopentylamino)benzoate;ethyl 3-amino-4-(cyclopropylamino)benzoate |
|---|---|
| PubChem CID | 160671023 |
| Molecular Formula | C26H36N4O4 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | ethyl 3-amino-4-(cyclopentylamino)benzoate;ethyl 3-amino-4-(cyclopropylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC2CC2)c(N)c1.CCOC(=O)c1ccc(NC2CCCC2)c(N)c1 |
| InChI | InChI=1S/C14H20N2O2.C12H16N2O2/c1-2-18-14(17)10-7-8-13(12(15)9-10)16-11-5-3-4-6-11;1-2-16-12(15)8-3-6-11(10(13)7-8)14-9-4-5-9/h7-9,11,16H,2-6,15H2,1H3;3,6-7,9,14H,2,4-5,13H2,1H3 |
| InChIKey | RMXWGWLQGCLETJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|