C15H22N2O2 — CID 54887805
3-amino-4-(cyclooctylamino)benzoic acid (PubChem CID 54887805) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-amino-4-(cyclooctylamino)benzoic acid.
| Compound Name | 3-amino-4-(cyclooctylamino)benzoic acid |
|---|---|
| PubChem CID | 54887805 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-amino-4-(cyclooctylamino)benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1NC1CCCCCCC1 |
| InChI | InChI=1S/C15H22N2O2/c16-13-10-11(15(18)19)8-9-14(13)17-12-6-4-2-1-3-5-7-12/h8-10,12,17H,1-7,16H2,(H,18,19) |
| InChIKey | ALGBLSZINHPQSW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|