C15H23FN2 — CID 62376796
4-fluoro-2-N-(4-propylcyclohexyl)benzene-1,2-diamine (PubChem CID 62376796) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is 4-fluoro-2-N-(4-propylcyclohexyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-2-N-(4-propylcyclohexyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 62376796 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 4-fluoro-2-N-(4-propylcyclohexyl)benzene-1,2-diamine |
| SMILES | CCCC1CCC(Nc2cc(F)ccc2N)CC1 |
| InChI | InChI=1S/C15H23FN2/c1-2-3-11-4-7-13(8-5-11)18-15-10-12(16)6-9-14(15)17/h6,9-11,13,18H,2-5,7-8,17H2,1H3 |
| InChIKey | VHLRKQGFWYNONU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|