C14H18FN3O3 — CID 89064489
ethyl 4-(4-fluoro-2-nitrosoanilino)piperidine-1-carboxylate (PubChem CID 89064489) has the molecular formula C14H18FN3O3 and a molecular weight of 295.31 g/mol. Its IUPAC name is ethyl 4-(4-fluoro-2-nitrosoanilino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(4-fluoro-2-nitrosoanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89064489 |
| Molecular Formula | C14H18FN3O3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | ethyl 4-(4-fluoro-2-nitrosoanilino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(F)cc2N=O)CC1 |
| InChI | InChI=1S/C14H18FN3O3/c1-2-21-14(19)18-7-5-11(6-8-18)16-12-4-3-10(15)9-13(12)17-20/h3-4,9,11,16H,2,5-8H2,1H3 |
| InChIKey | RFTDDPYSAFUJBI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |