C15H20ClN3O3 — CID 168651983
ethyl 4-(4-chloro-2-formamidoanilino)piperidine-1-carboxylate (PubChem CID 168651983) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is ethyl 4-(4-chloro-2-formamidoanilino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(4-chloro-2-formamidoanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168651983 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | ethyl 4-(4-chloro-2-formamidoanilino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(Cl)cc2NC=O)CC1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-2-22-15(21)19-7-5-12(6-8-19)18-13-4-3-11(16)9-14(13)17-10-20/h3-4,9-10,12,18H,2,5-8H2,1H3,(H,17,20) |
| InChIKey | WVQJHYQQYDWVDJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|