C23H24ClN3O2 — CID 166442180
ethyl 4-[(7-chloro-2-phenylquinolin-4-yl)amino]piperidine-1-carboxylate (PubChem CID 166442180) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is ethyl 4-[(7-chloro-2-phenylquinolin-4-yl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(7-chloro-2-phenylquinolin-4-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166442180 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | ethyl 4-[(7-chloro-2-phenylquinolin-4-yl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2cc(-c3ccccc3)nc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C23H24ClN3O2/c1-2-29-23(28)27-12-10-18(11-13-27)25-22-15-20(16-6-4-3-5-7-16)26-21-14-17(24)8-9-19(21)22/h3-9,14-15,18H,2,10-13H2,1H3,(H,25,26) |
| InChIKey | OASQSLWZJHSNLF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |