C16H19N3O4 — CID 72702552
ethyl 4-[(4-oxo-3,1-benzoxazin-2-yl)amino]piperidine-1-carboxylate (PubChem CID 72702552) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is ethyl 4-[(4-oxo-3,1-benzoxazin-2-yl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4-oxo-3,1-benzoxazin-2-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 72702552 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethyl 4-[(4-oxo-3,1-benzoxazin-2-yl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2nc3ccccc3c(=O)o2)CC1 |
| InChI | InChI=1S/C16H19N3O4/c1-2-22-16(21)19-9-7-11(8-10-19)17-15-18-13-6-4-3-5-12(13)14(20)23-15/h3-6,11H,2,7-10H2,1H3,(H,17,18) |
| InChIKey | ICZZPFZNCCVZCI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |