C16H22Cl2N4O2 — CID 169368878
ethyl 4-[2-[(1-amino-2-chloroethylidene)amino]-4-chloroanilino]piperidine-1-carboxylate (PubChem CID 169368878) has the molecular formula C16H22Cl2N4O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is ethyl 4-[2-[(1-amino-2-chloroethylidene)amino]-4-chloroanilino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(1-amino-2-chloroethylidene)amino]-4-chloroanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169368878 |
| Molecular Formula | C16H22Cl2N4O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | ethyl 4-[2-[(1-amino-2-chloroethylidene)amino]-4-chloroanilino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(Cl)cc2/N=C(/N)CCl)CC1 |
| InChI | InChI=1S/C16H22Cl2N4O2/c1-2-24-16(23)22-7-5-12(6-8-22)20-13-4-3-11(18)9-14(13)21-15(19)10-17/h3-4,9,12,20H,2,5-8,10H2,1H3,(H2,19,21) |
| InChIKey | XFXILTFFRBGWBC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|