C14H18FIN2O2 — CID 79768815
ethyl 4-(4-fluoro-2-iodoanilino)piperidine-1-carboxylate (PubChem CID 79768815) has the molecular formula C14H18FIN2O2 and a molecular weight of 392.21 g/mol. Its IUPAC name is ethyl 4-(4-fluoro-2-iodoanilino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(4-fluoro-2-iodoanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 79768815 |
| Molecular Formula | C14H18FIN2O2 |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | ethyl 4-(4-fluoro-2-iodoanilino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(F)cc2I)CC1 |
| InChI | InChI=1S/C14H18FIN2O2/c1-2-20-14(19)18-7-5-11(6-8-18)17-13-4-3-10(15)9-12(13)16/h3-4,9,11,17H,2,5-8H2,1H3 |
| InChIKey | JAMLNRTVZGHVND-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|