C14H17BrCl2N2O2 — CID 107787982
ethyl 4-(4-bromo-2,3-dichloroanilino)piperidine-1-carboxylate (PubChem CID 107787982) has the molecular formula C14H17BrCl2N2O2 and a molecular weight of 396.11 g/mol. Its IUPAC name is ethyl 4-(4-bromo-2,3-dichloroanilino)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(4-bromo-2,3-dichloroanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107787982 |
| Molecular Formula | C14H17BrCl2N2O2 |
| Molecular Weight | 396.11 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | ethyl 4-(4-bromo-2,3-dichloroanilino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(Br)c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C14H17BrCl2N2O2/c1-2-21-14(20)19-7-5-9(6-8-19)18-11-4-3-10(15)12(16)13(11)17/h3-4,9,18H,2,5-8H2,1H3 |
| InChIKey | HSNKCWXEEKIZIN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.11 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|