C19H19ClN6O2 — CID 168609938
ethyl 4-[4-chloro-2-(1,2,2-tricyanoethenylamino)anilino]piperidine-1-carboxylate (PubChem CID 168609938) has the molecular formula C19H19ClN6O2 and a molecular weight of 398.85 g/mol. Its IUPAC name is ethyl 4-[4-chloro-2-(1,2,2-tricyanoethenylamino)anilino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-chloro-2-(1,2,2-tricyanoethenylamino)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168609938 |
| Molecular Formula | C19H19ClN6O2 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | ethyl 4-[4-chloro-2-(1,2,2-tricyanoethenylamino)anilino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc(Cl)cc2NC(C#N)=C(C#N)C#N)CC1 |
| InChI | InChI=1S/C19H19ClN6O2/c1-2-28-19(27)26-7-5-15(6-8-26)24-16-4-3-14(20)9-17(16)25-18(12-23)13(10-21)11-22/h3-4,9,15,24-25H,2,5-8H2,1H3 |
| InChIKey | FLOPBQQRZVYCDM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|