C16H20F2N2O3 — CID 4818400
ethyl 1-[2-(2,4-difluoroanilino)-2-oxoethyl]piperidine-4-carboxylate (PubChem CID 4818400) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is ethyl 1-[2-(2,4-difluoroanilino)-2-oxoethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(2,4-difluoroanilino)-2-oxoethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4818400 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ethyl 1-[2-(2,4-difluoroanilino)-2-oxoethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CC(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C16H20F2N2O3/c1-2-23-16(22)11-5-7-20(8-6-11)10-15(21)19-14-4-3-12(17)9-13(14)18/h3-4,9,11H,2,5-8,10H2,1H3,(H,19,21) |
| InChIKey | IZOKKGWCKQFKHJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |