C19H26N2O4 — CID 54838112
ethyl 1-[2-oxo-2-(2-prop-2-enoxyanilino)ethyl]piperidine-4-carboxylate (PubChem CID 54838112) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl 1-[2-oxo-2-(2-prop-2-enoxyanilino)ethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-oxo-2-(2-prop-2-enoxyanilino)ethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 54838112 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | ethyl 1-[2-oxo-2-(2-prop-2-enoxyanilino)ethyl]piperidine-4-carboxylate |
| SMILES | C=CCOc1ccccc1NC(=O)CN1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C19H26N2O4/c1-3-13-25-17-8-6-5-7-16(17)20-18(22)14-21-11-9-15(10-12-21)19(23)24-4-2/h3,5-8,15H,1,4,9-14H2,2H3,(H,20,22) |
| InChIKey | GRKNMZHICXZAFI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|