C23H26FN3O4 — CID 26629566
ethyl 1-[2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]piperidine-4-carboxylate (PubChem CID 26629566) has the molecular formula C23H26FN3O4 and a molecular weight of 427.48 g/mol. Its IUPAC name is ethyl 1-[2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 26629566 |
| Molecular Formula | C23H26FN3O4 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | ethyl 1-[2-[2-[(4-fluorophenyl)carbamoyl]anilino]-2-oxoethyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CC(=O)Nc2ccccc2C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H26FN3O4/c1-2-31-23(30)16-11-13-27(14-12-16)15-21(28)26-20-6-4-3-5-19(20)22(29)25-18-9-7-17(24)8-10-18/h3-10,16H,2,11-15H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | PVQLCQWAMLMVRC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |