C17H21FN6O2 — CID 51964330
4-N-cyclopropyl-2-N-[(2R)-2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 51964330) has the molecular formula C17H21FN6O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is 4-N-cyclopropyl-2-N-[(2R)-2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclopropyl-2-N-[(2R)-2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 51964330 |
| Molecular Formula | C17H21FN6O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-N-cyclopropyl-2-N-[(2R)-2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | CN(C)[C@@H](CNc1ncc([N+](=O)[O-])c(NC2CC2)n1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN6O2/c1-23(2)14(11-3-5-12(18)6-4-11)9-19-17-20-10-15(24(25)26)16(22-17)21-13-7-8-13/h3-6,10,13-14H,7-9H2,1-2H3,(H2,19,20,21,22)/t14-/m0/s1 |
| InChIKey | XITHVQIUYVGJNJ-AWEZNQCLSA-N |
| XLogP | 2.81 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|