C20H25FN6O5 — CID 67047148
tert-butyl-[4-fluoro-2-[[5-nitro-4-(oxan-4-ylamino)pyrimidin-2-yl]amino]phenyl]carbamic acid (PubChem CID 67047148) has the molecular formula C20H25FN6O5 and a molecular weight of 448.46 g/mol. Its IUPAC name is tert-butyl-[4-fluoro-2-[[5-nitro-4-(oxan-4-ylamino)pyrimidin-2-yl]amino]phenyl]carbamic acid.
| Compound Name | tert-butyl-[4-fluoro-2-[[5-nitro-4-(oxan-4-ylamino)pyrimidin-2-yl]amino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 67047148 |
| Molecular Formula | C20H25FN6O5 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | tert-butyl-[4-fluoro-2-[[5-nitro-4-(oxan-4-ylamino)pyrimidin-2-yl]amino]phenyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1ccc(F)cc1Nc1ncc([N+](=O)[O-])c(NC2CCOCC2)n1 |
| InChI | InChI=1S/C20H25FN6O5/c1-20(2,3)26(19(28)29)15-5-4-12(21)10-14(15)24-18-22-11-16(27(30)31)17(25-18)23-13-6-8-32-9-7-13/h4-5,10-11,13H,6-9H2,1-3H3,(H,28,29)(H2,22,23,24,25) |
| InChIKey | KJUPQCJJPHOLQO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|