C17H26FN5O3 — CID 142554665
4-N-(4,4-dimethylcyclohexyl)-2-N-[(3S,4R)-3-fluorooxan-4-yl]-5-nitropyrimidine-2,4-diamine (PubChem CID 142554665) has the molecular formula C17H26FN5O3 and a molecular weight of 367.43 g/mol. Its IUPAC name is 4-N-(4,4-dimethylcyclohexyl)-2-N-[(3S,4R)-3-fluorooxan-4-yl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-(4,4-dimethylcyclohexyl)-2-N-[(3S,4R)-3-fluorooxan-4-yl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142554665 |
| Molecular Formula | C17H26FN5O3 |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 4-N-(4,4-dimethylcyclohexyl)-2-N-[(3S,4R)-3-fluorooxan-4-yl]-5-nitropyrimidine-2,4-diamine |
| SMILES | CC1(C)CCC(Nc2nc(N[C@@H]3CCOC[C@H]3F)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H26FN5O3/c1-17(2)6-3-11(4-7-17)20-15-14(23(24)25)9-19-16(22-15)21-13-5-8-26-10-12(13)18/h9,11-13H,3-8,10H2,1-2H3,(H2,19,20,21,22)/t12-,13-/m1/s1 |
| InChIKey | IIITYIGCURKZHE-CHWSQXEVSA-N |
| XLogP | 3.30 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|