C14H21N5O3 — CID 95774894
[(1S,2R)-2-[[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]amino]cyclohexyl]methanol (PubChem CID 95774894) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is [(1S,2R)-2-[[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]amino]cyclohexyl]methanol.
| Compound Name | [(1S,2R)-2-[[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 95774894 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [(1S,2R)-2-[[4-(cyclopropylamino)-5-nitropyrimidin-2-yl]amino]cyclohexyl]methanol |
| SMILES | O=[N+]([O-])c1cnc(N[C@@H]2CCCC[C@@H]2CO)nc1NC1CC1 |
| InChI | InChI=1S/C14H21N5O3/c20-8-9-3-1-2-4-11(9)17-14-15-7-12(19(21)22)13(18-14)16-10-5-6-10/h7,9-11,20H,1-6,8H2,(H2,15,16,17,18)/t9-,11-/m1/s1 |
| InChIKey | ADWVGMOUEGPBIT-MWLCHTKSSA-N |
| XLogP | 1.92 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|