C17H28N6O2 — CID 52599420
2-N-[(2S)-2-cyclohexyl-2-(dimethylamino)ethyl]-4-N-cyclopropyl-5-nitropyrimidine-2,4-diamine (PubChem CID 52599420) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-N-[(2S)-2-cyclohexyl-2-(dimethylamino)ethyl]-4-N-cyclopropyl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[(2S)-2-cyclohexyl-2-(dimethylamino)ethyl]-4-N-cyclopropyl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 52599420 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-N-[(2S)-2-cyclohexyl-2-(dimethylamino)ethyl]-4-N-cyclopropyl-5-nitropyrimidine-2,4-diamine |
| SMILES | CN(C)[C@H](CNc1ncc([N+](=O)[O-])c(NC2CC2)n1)C1CCCCC1 |
| InChI | InChI=1S/C17H28N6O2/c1-22(2)14(12-6-4-3-5-7-12)10-18-17-19-11-15(23(24)25)16(21-17)20-13-8-9-13/h11-14H,3-10H2,1-2H3,(H2,18,19,20,21)/t14-/m1/s1 |
| InChIKey | VNVPUBDZYBMAMA-CQSZACIVSA-N |
| XLogP | 2.88 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|