C14H24N6O — CID 70981953
2-(2-aminopropylamino)-4-(cyclohexylamino)pyrimidine-5-carboxamide (PubChem CID 70981953) has the molecular formula C14H24N6O and a molecular weight of 292.39 g/mol. Its IUPAC name is 2-(2-aminopropylamino)-4-(cyclohexylamino)pyrimidine-5-carboxamide.
| Compound Name | 2-(2-aminopropylamino)-4-(cyclohexylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70981953 |
| Molecular Formula | C14H24N6O |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-(2-aminopropylamino)-4-(cyclohexylamino)pyrimidine-5-carboxamide |
| SMILES | CC(N)CNc1ncc(C(N)=O)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C14H24N6O/c1-9(15)7-17-14-18-8-11(12(16)21)13(20-14)19-10-5-3-2-4-6-10/h8-10H,2-7,15H2,1H3,(H2,16,21)(H2,17,18,19,20) |
| InChIKey | UAYBCKVPLZGCSH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |