C22H37N5O — CID 144944262
2-(butylamino)-4-(cyclohexylamino)-N-(cyclohexylmethyl)pyrimidine-5-carboxamide (PubChem CID 144944262) has the molecular formula C22H37N5O and a molecular weight of 387.57 g/mol. Its IUPAC name is 2-(butylamino)-4-(cyclohexylamino)-N-(cyclohexylmethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(butylamino)-4-(cyclohexylamino)-N-(cyclohexylmethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 144944262 |
| Molecular Formula | C22H37N5O |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | 2-(butylamino)-4-(cyclohexylamino)-N-(cyclohexylmethyl)pyrimidine-5-carboxamide |
| SMILES | CCCCNc1ncc(C(=O)NCC2CCCCC2)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C22H37N5O/c1-2-3-14-23-22-25-16-19(20(27-22)26-18-12-8-5-9-13-18)21(28)24-15-17-10-6-4-7-11-17/h16-18H,2-15H2,1H3,(H,24,28)(H2,23,25,26,27) |
| InChIKey | KKEPTXMUQBERSC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|