C24H42N6O — CID 144944253
2-(butylamino)-4-(cyclohexylamino)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]pyrimidine-5-carboxamide (PubChem CID 144944253) has the molecular formula C24H42N6O and a molecular weight of 430.64 g/mol. Its IUPAC name is 2-(butylamino)-4-(cyclohexylamino)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(butylamino)-4-(cyclohexylamino)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 144944253 |
| Molecular Formula | C24H42N6O |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | 2-(butylamino)-4-(cyclohexylamino)-N-[(1-propan-2-ylpiperidin-4-yl)methyl]pyrimidine-5-carboxamide |
| SMILES | CCCCNc1ncc(C(=O)NCC2CCN(C(C)C)CC2)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C24H42N6O/c1-4-5-13-25-24-27-17-21(22(29-24)28-20-9-7-6-8-10-20)23(31)26-16-19-11-14-30(15-12-19)18(2)3/h17-20H,4-16H2,1-3H3,(H,26,31)(H2,25,27,28,29) |
| InChIKey | FEYRVJLKIOSNAT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|