C19H31N5O4 — CID 171483040
2-(butylamino)-4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]pyrimidine-5-carboxylic acid (PubChem CID 171483040) has the molecular formula C19H31N5O4 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-(butylamino)-4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]pyrimidine-5-carboxylic acid.
| Compound Name | 2-(butylamino)-4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 171483040 |
| Molecular Formula | C19H31N5O4 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 2-(butylamino)-4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]pyrimidine-5-carboxylic acid |
| SMILES | CCCCNc1ncc(C(=O)O)c(NC2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C19H31N5O4/c1-5-6-9-20-17-21-12-14(16(25)26)15(23-17)22-13-7-10-24(11-8-13)18(27)28-19(2,3)4/h12-13H,5-11H2,1-4H3,(H,25,26)(H2,20,21,22,23) |
| InChIKey | AOUBGYTWCQAATO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|