C19H32BrN5O2 — CID 140752162
tert-butyl N-[4-[[5-bromo-2-(butylamino)pyrimidin-4-yl]amino]cyclohexyl]carbamate (PubChem CID 140752162) has the molecular formula C19H32BrN5O2 and a molecular weight of 442.40 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-bromo-2-(butylamino)pyrimidin-4-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-bromo-2-(butylamino)pyrimidin-4-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 140752162 |
| Molecular Formula | C19H32BrN5O2 |
| Molecular Weight | 442.40 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | tert-butyl N-[4-[[5-bromo-2-(butylamino)pyrimidin-4-yl]amino]cyclohexyl]carbamate |
| SMILES | CCCCNc1ncc(Br)c(NC2CCC(NC(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C19H32BrN5O2/c1-5-6-11-21-17-22-12-15(20)16(25-17)23-13-7-9-14(10-8-13)24-18(26)27-19(2,3)4/h12-14H,5-11H2,1-4H3,(H,24,26)(H2,21,22,23,25) |
| InChIKey | OTQQPDWJIBOBSO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|