C15H25BrN4 — CID 166723883
5-bromo-2-N-butyl-4-N-(cyclohexylmethyl)pyrimidine-2,4-diamine (PubChem CID 166723883) has the molecular formula C15H25BrN4 and a molecular weight of 341.30 g/mol. Its IUPAC name is 5-bromo-2-N-butyl-4-N-(cyclohexylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 5-bromo-2-N-butyl-4-N-(cyclohexylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166723883 |
| Molecular Formula | C15H25BrN4 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-bromo-2-N-butyl-4-N-(cyclohexylmethyl)pyrimidine-2,4-diamine |
| SMILES | CCCCNc1ncc(Br)c(NCC2CCCCC2)n1 |
| InChI | InChI=1S/C15H25BrN4/c1-2-3-9-17-15-19-11-13(16)14(20-15)18-10-12-7-5-4-6-8-12/h11-12H,2-10H2,1H3,(H2,17,18,19,20) |
| InChIKey | YRSSKTFMPFSEFY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|