C10H16BrN5 — CID 80894632
5-bromo-N-(cyclopentylmethyl)-2-hydrazinylpyrimidin-4-amine (PubChem CID 80894632) has the molecular formula C10H16BrN5 and a molecular weight of 286.18 g/mol. Its IUPAC name is 5-bromo-N-(cyclopentylmethyl)-2-hydrazinylpyrimidin-4-amine.
| Compound Name | 5-bromo-N-(cyclopentylmethyl)-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80894632 |
| Molecular Formula | C10H16BrN5 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 5-bromo-N-(cyclopentylmethyl)-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1ncc(Br)c(NCC2CCCC2)n1 |
| InChI | InChI=1S/C10H16BrN5/c11-8-6-14-10(16-12)15-9(8)13-5-7-3-1-2-4-7/h6-7H,1-5,12H2,(H2,13,14,15,16) |
| InChIKey | JXOUSHDDJMFBCV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|