C20H27BrN4O2 — CID 142489009
tert-butyl N-[4-[(6-bromo-8-methylquinazolin-2-yl)amino]cyclohexyl]carbamate (PubChem CID 142489009) has the molecular formula C20H27BrN4O2 and a molecular weight of 435.37 g/mol. Its IUPAC name is tert-butyl N-[4-[(6-bromo-8-methylquinazolin-2-yl)amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(6-bromo-8-methylquinazolin-2-yl)amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 142489009 |
| Molecular Formula | C20H27BrN4O2 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | tert-butyl N-[4-[(6-bromo-8-methylquinazolin-2-yl)amino]cyclohexyl]carbamate |
| SMILES | Cc1cc(Br)cc2cnc(NC3CCC(NC(=O)OC(C)(C)C)CC3)nc12 |
| InChI | InChI=1S/C20H27BrN4O2/c1-12-9-14(21)10-13-11-22-18(25-17(12)13)23-15-5-7-16(8-6-15)24-19(26)27-20(2,3)4/h9-11,15-16H,5-8H2,1-4H3,(H,24,26)(H,22,23,25) |
| InChIKey | UXPDBKOPJRJBOE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |