C17H24Br2N2O2 — CID 103715445
tert-butyl N-[4-(2,5-dibromoanilino)cyclohexyl]carbamate (PubChem CID 103715445) has the molecular formula C17H24Br2N2O2 and a molecular weight of 448.20 g/mol. Its IUPAC name is tert-butyl N-[4-(2,5-dibromoanilino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,5-dibromoanilino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 103715445 |
| Molecular Formula | C17H24Br2N2O2 |
| Molecular Weight | 448.20 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | tert-butyl N-[4-(2,5-dibromoanilino)cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Nc2cc(Br)ccc2Br)CC1 |
| InChI | InChI=1S/C17H24Br2N2O2/c1-17(2,3)23-16(22)21-13-7-5-12(6-8-13)20-15-10-11(18)4-9-14(15)19/h4,9-10,12-13,20H,5-8H2,1-3H3,(H,21,22) |
| InChIKey | DYFZRIPTWZROOI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.20 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |