C19H29BrN2O2 — CID 113259602
tert-butyl N-[4-(4-bromo-2-ethylanilino)cyclohexyl]carbamate (PubChem CID 113259602) has the molecular formula C19H29BrN2O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is tert-butyl N-[4-(4-bromo-2-ethylanilino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-bromo-2-ethylanilino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 113259602 |
| Molecular Formula | C19H29BrN2O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | tert-butyl N-[4-(4-bromo-2-ethylanilino)cyclohexyl]carbamate |
| SMILES | CCc1cc(Br)ccc1NC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H29BrN2O2/c1-5-13-12-14(20)6-11-17(13)21-15-7-9-16(10-8-15)22-18(23)24-19(2,3)4/h6,11-12,15-16,21H,5,7-10H2,1-4H3,(H,22,23) |
| InChIKey | QJGCWMBDLTYKOP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |