C18H27BrN2O2 — CID 103821402
tert-butyl N-[4-(2-bromo-3-methylanilino)cyclohexyl]carbamate (PubChem CID 103821402) has the molecular formula C18H27BrN2O2 and a molecular weight of 383.33 g/mol. Its IUPAC name is tert-butyl N-[4-(2-bromo-3-methylanilino)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-bromo-3-methylanilino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 103821402 |
| Molecular Formula | C18H27BrN2O2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | tert-butyl N-[4-(2-bromo-3-methylanilino)cyclohexyl]carbamate |
| SMILES | Cc1cccc(NC2CCC(NC(=O)OC(C)(C)C)CC2)c1Br |
| InChI | InChI=1S/C18H27BrN2O2/c1-12-6-5-7-15(16(12)19)20-13-8-10-14(11-9-13)21-17(22)23-18(2,3)4/h5-7,13-14,20H,8-11H2,1-4H3,(H,21,22) |
| InChIKey | OYRDYCWGQDXYIE-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |