C17H26F2N6O2 — CID 137399146
N-(azetidin-3-yl)-4-(cyclohexylamino)-2-[2-(difluoromethoxy)ethylamino]pyrimidine-5-carboxamide (PubChem CID 137399146) has the molecular formula C17H26F2N6O2 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-(azetidin-3-yl)-4-(cyclohexylamino)-2-[2-(difluoromethoxy)ethylamino]pyrimidine-5-carboxamide.
| Compound Name | N-(azetidin-3-yl)-4-(cyclohexylamino)-2-[2-(difluoromethoxy)ethylamino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137399146 |
| Molecular Formula | C17H26F2N6O2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | N-(azetidin-3-yl)-4-(cyclohexylamino)-2-[2-(difluoromethoxy)ethylamino]pyrimidine-5-carboxamide |
| SMILES | O=C(NC1CNC1)c1cnc(NCCOC(F)F)nc1NC1CCCCC1 |
| InChI | InChI=1S/C17H26F2N6O2/c18-16(19)27-7-6-21-17-22-10-13(15(26)24-12-8-20-9-12)14(25-17)23-11-4-2-1-3-5-11/h10-12,16,20H,1-9H2,(H,24,26)(H2,21,22,23,25) |
| InChIKey | MTAGCBJSVRVUAE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|