C21H36N6O — CID 123248558
2-(butylamino)-4-(cyclohexylamino)-N-(piperidin-4-ylmethyl)pyrimidine-5-carboxamide (PubChem CID 123248558) has the molecular formula C21H36N6O and a molecular weight of 388.56 g/mol. Its IUPAC name is 2-(butylamino)-4-(cyclohexylamino)-N-(piperidin-4-ylmethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(butylamino)-4-(cyclohexylamino)-N-(piperidin-4-ylmethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123248558 |
| Molecular Formula | C21H36N6O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | 2-(butylamino)-4-(cyclohexylamino)-N-(piperidin-4-ylmethyl)pyrimidine-5-carboxamide |
| SMILES | CCCCNc1ncc(C(=O)NCC2CCNCC2)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C21H36N6O/c1-2-3-11-23-21-25-15-18(19(27-21)26-17-7-5-4-6-8-17)20(28)24-14-16-9-12-22-13-10-16/h15-17,22H,2-14H2,1H3,(H,24,28)(H2,23,25,26,27) |
| InChIKey | FPBRUHGIPQEMQK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|