C28H46N6O — CID 144944254
2-(butylamino)-4-(cyclohexylamino)-N-[[1-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-4-yl]methyl]pyrimidine-5-carboxamide (PubChem CID 144944254) has the molecular formula C28H46N6O and a molecular weight of 482.72 g/mol. Its IUPAC name is 2-(butylamino)-4-(cyclohexylamino)-N-[[1-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-4-yl]methyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(butylamino)-4-(cyclohexylamino)-N-[[1-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-4-yl]methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 144944254 |
| Molecular Formula | C28H46N6O |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.37 |
| IUPAC Name | 2-(butylamino)-4-(cyclohexylamino)-N-[[1-[(2Z,4E)-hepta-2,4-dien-4-yl]piperidin-4-yl]methyl]pyrimidine-5-carboxamide |
| SMILES | C/C=C\C(=C/CC)N1CCC(CNC(=O)c2cnc(NCCCC)nc2NC2CCCCC2)CC1 |
| InChI | InChI=1S/C28H46N6O/c1-4-7-17-29-28-31-21-25(26(33-28)32-23-13-9-8-10-14-23)27(35)30-20-22-15-18-34(19-16-22)24(11-5-2)12-6-3/h5,11-12,21-23H,4,6-10,13-20H2,1-3H3,(H,30,35)(H2,29,31,32,33)/b11-5-,24-12+ |
| InChIKey | VWVZEXSGHIRPPL-METPSSNMSA-N |
| XLogP | 5.74 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|