C25H32N6O2 — CID 118439812
2-(butylamino)-4-[(4-hydroxycyclohexyl)amino]-N-(quinolin-2-ylmethyl)pyrimidine-5-carboxamide (PubChem CID 118439812) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2-(butylamino)-4-[(4-hydroxycyclohexyl)amino]-N-(quinolin-2-ylmethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(butylamino)-4-[(4-hydroxycyclohexyl)amino]-N-(quinolin-2-ylmethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118439812 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 2-(butylamino)-4-[(4-hydroxycyclohexyl)amino]-N-(quinolin-2-ylmethyl)pyrimidine-5-carboxamide |
| SMILES | CCCCNc1ncc(C(=O)NCc2ccc3ccccc3n2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C25H32N6O2/c1-2-3-14-26-25-28-16-21(23(31-25)30-18-10-12-20(32)13-11-18)24(33)27-15-19-9-8-17-6-4-5-7-22(17)29-19/h4-9,16,18,20,32H,2-3,10-15H2,1H3,(H,27,33)(H2,26,28,30,31) |
| InChIKey | BXUFOWVQUPXSQM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|