C27H38N6O3 — CID 123644513
2-(butylamino)-4-[(4-hydroxycyclohexyl)methylamino]-N-[[6-(1-methoxybuta-1,3-dienyl)-3-pyridinyl]methyl]pyrimidine-5-carboxamide (PubChem CID 123644513) has the molecular formula C27H38N6O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-(butylamino)-4-[(4-hydroxycyclohexyl)methylamino]-N-[[6-(1-methoxybuta-1,3-dienyl)-3-pyridinyl]methyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(butylamino)-4-[(4-hydroxycyclohexyl)methylamino]-N-[[6-(1-methoxybuta-1,3-dienyl)-3-pyridinyl]methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123644513 |
| Molecular Formula | C27H38N6O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 2-(butylamino)-4-[(4-hydroxycyclohexyl)methylamino]-N-[[6-(1-methoxybuta-1,3-dienyl)-3-pyridinyl]methyl]pyrimidine-5-carboxamide |
| SMILES | C=CC=C(OC)c1ccc(CNC(=O)c2cnc(NCCCC)nc2NCC2CCC(O)CC2)cn1 |
| InChI | InChI=1S/C27H38N6O3/c1-4-6-14-28-27-32-18-22(25(33-27)30-15-19-8-11-21(34)12-9-19)26(35)31-17-20-10-13-23(29-16-20)24(36-3)7-5-2/h5,7,10,13,16,18-19,21,34H,2,4,6,8-9,11-12,14-15,17H2,1,3H3,(H,31,35)(H2,28,30,32,33) |
| InChIKey | KTCQNUWSLDEKQC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|