C28H38N6O — CID 123148798
4-[[[5-[5-[(benzylamino)methyl]-2-pyridinyl]-2-(butylamino)pyrimidin-4-yl]amino]methyl]cyclohexan-1-ol (PubChem CID 123148798) has the molecular formula C28H38N6O and a molecular weight of 474.65 g/mol. Its IUPAC name is 4-[[[5-[5-[(benzylamino)methyl]-2-pyridinyl]-2-(butylamino)pyrimidin-4-yl]amino]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[[5-[5-[(benzylamino)methyl]-2-pyridinyl]-2-(butylamino)pyrimidin-4-yl]amino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 123148798 |
| Molecular Formula | C28H38N6O |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | 4-[[[5-[5-[(benzylamino)methyl]-2-pyridinyl]-2-(butylamino)pyrimidin-4-yl]amino]methyl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2ccc(CNCc3ccccc3)cn2)c(NCC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C28H38N6O/c1-2-3-15-30-28-33-20-25(27(34-28)32-18-22-9-12-24(35)13-10-22)26-14-11-23(19-31-26)17-29-16-21-7-5-4-6-8-21/h4-8,11,14,19-20,22,24,29,35H,2-3,9-10,12-13,15-18H2,1H3,(H2,30,32,33,34) |
| InChIKey | CBZVUAVLYQYYJZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|