C18H27N7O — CID 118439924
4-[[5-(2-aminopyrimidin-4-yl)-2-(butylamino)pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 118439924) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-[[5-(2-aminopyrimidin-4-yl)-2-(butylamino)pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[5-(2-aminopyrimidin-4-yl)-2-(butylamino)pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 118439924 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 4-[[5-(2-aminopyrimidin-4-yl)-2-(butylamino)pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2ccnc(N)n2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C18H27N7O/c1-2-3-9-21-18-22-11-14(15-8-10-20-17(19)24-15)16(25-18)23-12-4-6-13(26)7-5-12/h8,10-13,26H,2-7,9H2,1H3,(H2,19,20,24)(H2,21,22,23,25) |
| InChIKey | AAUNIEBMIUGNTA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|