C19H26FN5O — CID 170437926
4-[[2-[[(2R)-2-fluorobutyl]amino]-5-pyridin-2-ylpyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 170437926) has the molecular formula C19H26FN5O and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-[[2-[[(2R)-2-fluorobutyl]amino]-5-pyridin-2-ylpyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-[[(2R)-2-fluorobutyl]amino]-5-pyridin-2-ylpyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 170437926 |
| Molecular Formula | C19H26FN5O |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 4-[[2-[[(2R)-2-fluorobutyl]amino]-5-pyridin-2-ylpyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CC[C@@H](F)CNc1ncc(-c2ccccn2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C19H26FN5O/c1-2-13(20)11-22-19-23-12-16(17-5-3-4-10-21-17)18(25-19)24-14-6-8-15(26)9-7-14/h3-5,10,12-15,26H,2,6-9,11H2,1H3,(H2,22,23,24,25)/t13-,14?,15?/m1/s1 |
| InChIKey | ATXUHICBTCQJEN-WLYUNCDWSA-N |
| XLogP | 3.41 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |