C21H29N5 — CID 123184269
2-N,4-N-dicyclohexyl-5-pyridin-2-ylpyrimidine-2,4-diamine (PubChem CID 123184269) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is 2-N,4-N-dicyclohexyl-5-pyridin-2-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-dicyclohexyl-5-pyridin-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 123184269 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2-N,4-N-dicyclohexyl-5-pyridin-2-ylpyrimidine-2,4-diamine |
| SMILES | c1ccc(-c2cnc(NC3CCCCC3)nc2NC2CCCCC2)nc1 |
| InChI | InChI=1S/C21H29N5/c1-3-9-16(10-4-1)24-20-18(19-13-7-8-14-22-19)15-23-21(26-20)25-17-11-5-2-6-12-17/h7-8,13-17H,1-6,9-12H2,(H2,23,24,25,26) |
| InChIKey | ABXCUHUSSJWLPM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |