C24H34FN5O2 — CID 170445767
4-[[2-[[(2S)-2-fluorobutyl]amino]-5-[5-(oxolan-3-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 170445767) has the molecular formula C24H34FN5O2 and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-[[2-[[(2S)-2-fluorobutyl]amino]-5-[5-(oxolan-3-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-[[(2S)-2-fluorobutyl]amino]-5-[5-(oxolan-3-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 170445767 |
| Molecular Formula | C24H34FN5O2 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 4-[[2-[[(2S)-2-fluorobutyl]amino]-5-[5-(oxolan-3-ylmethyl)-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CC[C@H](F)CNc1ncc(-c2ccc(CC3CCOC3)cn2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C24H34FN5O2/c1-2-18(25)13-27-24-28-14-21(23(30-24)29-19-4-6-20(31)7-5-19)22-8-3-16(12-26-22)11-17-9-10-32-15-17/h3,8,12,14,17-20,31H,2,4-7,9-11,13,15H2,1H3,(H2,27,28,29,30)/t17?,18-,19?,20?/m0/s1 |
| InChIKey | VXBYXRWVQNMKIY-MRXCCOFVSA-N |
| XLogP | 3.99 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |