C28H47N5 — CID 144944196
2-N-butyl-4-N-cyclohexyl-5-(5-heptan-4-yl-2-pyridinyl)pyrimidine-2,4-diamine;ethane (PubChem CID 144944196) has the molecular formula C28H47N5 and a molecular weight of 453.72 g/mol. Its IUPAC name is 2-N-butyl-4-N-cyclohexyl-5-(5-heptan-4-yl-2-pyridinyl)pyrimidine-2,4-diamine;ethane.
| Compound Name | 2-N-butyl-4-N-cyclohexyl-5-(5-heptan-4-yl-2-pyridinyl)pyrimidine-2,4-diamine;ethane |
|---|---|
| PubChem CID | 144944196 |
| Molecular Formula | C28H47N5 |
| Molecular Weight | 453.72 g/mol |
| Exact Mass | 453.38 |
| IUPAC Name | 2-N-butyl-4-N-cyclohexyl-5-(5-heptan-4-yl-2-pyridinyl)pyrimidine-2,4-diamine;ethane |
| SMILES | CC.CCCCNc1ncc(-c2ccc(C(CCC)CCC)cn2)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C26H41N5.C2H6/c1-4-7-17-27-26-29-19-23(25(31-26)30-22-13-9-8-10-14-22)24-16-15-21(18-28-24)20(11-5-2)12-6-3;1-2/h15-16,18-20,22H,4-14,17H2,1-3H3,(H2,27,29,30,31);1-2H3 |
| InChIKey | OHBDVYLUIOMCKQ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.72 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|