C24H36N6 — CID 123945731
2-N-butyl-4-N-cyclohexyl-5-(5-piperidin-4-yl-2-pyridinyl)pyrimidine-2,4-diamine (PubChem CID 123945731) has the molecular formula C24H36N6 and a molecular weight of 408.59 g/mol. Its IUPAC name is 2-N-butyl-4-N-cyclohexyl-5-(5-piperidin-4-yl-2-pyridinyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-butyl-4-N-cyclohexyl-5-(5-piperidin-4-yl-2-pyridinyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 123945731 |
| Molecular Formula | C24H36N6 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 2-N-butyl-4-N-cyclohexyl-5-(5-piperidin-4-yl-2-pyridinyl)pyrimidine-2,4-diamine |
| SMILES | CCCCNc1ncc(-c2ccc(C3CCNCC3)cn2)c(NC2CCCCC2)n1 |
| InChI | InChI=1S/C24H36N6/c1-2-3-13-26-24-28-17-21(23(30-24)29-20-7-5-4-6-8-20)22-10-9-19(16-27-22)18-11-14-25-15-12-18/h9-10,16-18,20,25H,2-8,11-15H2,1H3,(H2,26,28,29,30) |
| InChIKey | WDOLRXRCIJMMEL-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|