C19H28N6 — CID 72792975
2-N-butyl-4-N-(piperidin-4-ylmethyl)-5-pyridin-2-ylpyrimidine-2,4-diamine (PubChem CID 72792975) has the molecular formula C19H28N6 and a molecular weight of 340.48 g/mol. Its IUPAC name is 2-N-butyl-4-N-(piperidin-4-ylmethyl)-5-pyridin-2-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-butyl-4-N-(piperidin-4-ylmethyl)-5-pyridin-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 72792975 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-N-butyl-4-N-(piperidin-4-ylmethyl)-5-pyridin-2-ylpyrimidine-2,4-diamine |
| SMILES | CCCCNc1ncc(-c2ccccn2)c(NCC2CCNCC2)n1 |
| InChI | InChI=1S/C19H28N6/c1-2-3-9-22-19-24-14-16(17-6-4-5-10-21-17)18(25-19)23-13-15-7-11-20-12-8-15/h4-6,10,14-15,20H,2-3,7-9,11-13H2,1H3,(H2,22,23,24,25) |
| InChIKey | HVIDXJFXDHKCMO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|